CAS
91996-63-3 Purity
96%
91996-63-3 Purity
96%
![[(8R,9S,13S,14S,17S)-17-Hydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl]2-iodobenzoate](https://resource.alfa-chemistry.com/structure/91999-13-2.gif)
![(3R,5S,7R,8S,9S,10S,12S,13R,14S,17R)-10,13-Dimethyl-17-[(2R)-5,6,7-trihydroxyheptan-2-yl]-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene-3,7,12-triol](https://resource.alfa-chemistry.com/structure/91999-66-5.gif)
Inquiry Basket
Benzenebutanoicacid,b-amino-3-bromo-
CAS
919988-42-4
Catalog Number
ACM919988424
Category
Other Products
Molecular Formula
C10H12BrNO2
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the molecular formula of Benzenebutanoicacid,b-amino-3-bromo-?
The molecular formula of Benzenebutanoicacid,b-amino-3-bromo- is C10H13BrClNO2.
How is the molecular weight of Benzenebutanoicacid,b-amino-3-bromo- determined?
The molecular weight of Benzenebutanoicacid,b-amino-3-bromo- is computed by PubChem, and it is 294.57 g/mol.
What is the parent compound of Benzenebutanoicacid,b-amino-3-bromo-?
The parent compound of Benzenebutanoicacid,b-amino-3-bromo- is CID 90478030, which is (3S)-3-amino-4-(3-bromophenyl)butanoic acid.
What are the synonyms for Benzenebutanoicacid,b-amino-3-bromo-?
The synonyms for Benzenebutanoicacid,b-amino-3-bromo- are (3S)-3-amino-4-(3-bromophenyl)butanoic acid hydrochloride, (S)-3-Amino-4-(3-bromophenyl)butanoic acid hydrochloride, and Benzenebutanoicacid, b-amino-3-bromo-.
What is the IUPAC name of Benzenebutanoicacid,b-amino-3-bromo-?
The IUPAC name of Benzenebutanoicacid,b-amino-3-bromo- is (3S)-3-amino-4-(3-bromophenyl)butanoic acid hydrochloride.
What is the InChI key of Benzenebutanoicacid,b-amino-3-bromo-?
The InChI key of Benzenebutanoicacid,b-amino-3-bromo- is OWNVEWYNSXDFOL-FVGYRXGTSA-N.
What is the canonical SMILES of Benzenebutanoicacid,b-amino-3-bromo-?
The canonical SMILES of Benzenebutanoicacid,b-amino-3-bromo- is C1=CC(=CC(=C1)Br)CC(CC(=O)O)N.Cl.
What is the hydrogen bond donor count of Benzenebutanoicacid,b-amino-3-bromo-?
The hydrogen bond donor count of Benzenebutanoicacid,b-amino-3-bromo- is 3.
What is the hydrogen bond acceptor count of Benzenebutanoicacid,b-amino-3-bromo-?
The hydrogen bond acceptor count of Benzenebutanoicacid,b-amino-3-bromo- is 3.
Is Benzenebutanoicacid,b-amino-3-bromo- considered a canonicalized compound?
Yes, Benzenebutanoicacid,b-amino-3-bromo- is considered a canonicalized compound.
Recommended Products
![6-Bromo-7-methylimidazo[4,5-b]pyridine](https://resource.alfa-chemistry.com/structure/91996-63-3.gif)
![2-Chloropyrido[2,3-d]pyrimidine-4(1H)-thione](https://resource.alfa-chemistry.com/structure/91996-76-8.gif)
![4-Thioxo-3,4-dihydropyrido[2,3-d]pyrimidin-2(1H)-one](https://resource.alfa-chemistry.com/structure/91996-78-0.gif)
![Benzenebutanoic acid,3-bromo-b-[[(1,1-dimethylethoxy)carbonyl]amino]-](https://resource.alfa-chemistry.com/structure/919988-44-6.gif)
CAS
919988-44-6 Purity
---
919988-44-6 Purity
---
