91995-59-4 Purity
---
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula of the compound is C7H4ClN3S.
The molecular weight of the compound is 197.65 g/mol.
The IUPAC name of the compound is 2-chloro-1H-pyrido[2,3-d]pyrimidine-4-thione.
The InChI of the compound is InChI=1S/C7H4ClN3S/c8-7-10-5-4(6(12)11-7)2-1-3-9-5/h1-3H,(H,9,10,11,12).
The InChIKey of the compound is UKKAUWMAMJUALO-UHFFFAOYSA-N.
The canonical SMILES of the compound is C1=CC2=C(NC(=NC2=S)Cl)N=C1.
The XLogP3-AA value of the compound is 1.6.
The compound has 1 hydrogen bond donor count.
The compound has 2 hydrogen bond acceptor counts.
The compound has 0 rotatable bond counts.