91987-74-5 Purity
---
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula is C12H10NNaO8S2.
The molecular weight is 383.3 g/mol.
The IUPAC name is sodium;4-acetamido-5-hydroxy-7-sulfonaphthalene-2-sulfonate.
The InChI is InChI=1S/C12H11NO8S2.Na/c1-6(14)13-10-4-8(22(16,17)18)2-7-3-9(23(19,20)21)5-11(15)12(7)10;/h2-5,15H,1H3,(H,13,14)(H,16,17,18)(H,19,20,21);/q;+1/p-1
The Canonical SMILES is CC(=O)NC1=C2C(=CC(=C1)S(=O)(=O)[O-])C=C(C=C2O)S(=O)(=O)O.[Na+]
There are 3 hydrogen bond donor counts.
There are 8 hydrogen bond acceptor counts.
The exact mass is 382.97455291 g/mol.
The topological polar surface area is 178 Ų.
Yes, the compound is canonicalized.