What is the molecular formula of Acetonitrile,2-[(4-chlorophenyl)sulfonyl]-2-(hydroxyimino)-,sodium salt(1:1)?
The molecular formula is C8H4ClN2NaO3S.
What is the molecular weight of Acetonitrile,2-[(4-chlorophenyl)sulfonyl]-2-(hydroxyimino)-,sodium salt(1:1)?
The molecular weight is 266.64 g/mol.
When was the compound created and last modified?
The compound was created on 2008-02-05 and last modified on 2023-12-30.
What is the IUPAC Name of Acetonitrile,2-[(4-chlorophenyl)sulfonyl]-2-(hydroxyimino)-,sodium salt(1:1)?
The IUPAC Name is sodium;(1E)-1-(4-chlorophenyl)sulfonyl-N-oxidomethanimidoyl cyanide.
What is the InChI of Acetonitrile,2-[(4-chlorophenyl)sulfonyl]-2-(hydroxyimino)-,sodium salt(1:1)?
The InChI is InChI=1S/C8H5ClN2O3S.Na/c9-6-1-3-7(4-2-6)15(13,14)8(5-10)11-12;/h1-4,12H;/q;+1/p-1/b11-8+;
What is the Canonical SMILES of Acetonitrile,2-[(4-chlorophenyl)sulfonyl]-2-(hydroxyimino)-,sodium salt(1:1)?
The Canonical SMILES is C1=CC(=CC=C1S(=O)(=O)C(=N[O-])C#N)Cl.[Na+].
How many Hydrogen Bond Acceptor Count does Acetonitrile,2-[(4-chlorophenyl)sulfonyl]-2-(hydroxyimino)-,sodium salt(1:1) have?
It has 5 Hydrogen Bond Acceptor Count.
What is the Topological Polar Surface Area of Acetonitrile,2-[(4-chlorophenyl)sulfonyl]-2-(hydroxyimino)-,sodium salt(1:1)?
The Topological Polar Surface Area is 102 Ų.
How many Heavy Atom Count does Acetonitrile,2-[(4-chlorophenyl)sulfonyl]-2-(hydroxyimino)-,sodium salt(1:1) have?
It has 16 Heavy Atom Count.
Is the compound a Canonicalized compound?
Yes, the compound is Canonicalized.