CAS
91880-83-0 Purity
---
91880-83-0 Purity
---
Inquiry Basket
3-(1H-Imidazol-4-yl)-benzylamine 2hcl
CAS
918811-94-6
Catalog Number
ACM918811946
Category
Other Products
Molecular Weight
246.13632
Molecular Formula
C10H13Cl2N3
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
Specification
Synonyms
3-(1H-IMIDAZOL-4-YL)-BENZYLAMINE 2HCL
What is the molecular formula of the compound?
The molecular formula of the compound is C10H13Cl2N3.
What are the synonyms of the compound?
The synonyms of the compound are 918811-94-6, 3-(1H-Imidazol-4-yl)-benzylamine dihydrochloride, (3-(1H-Imidazol-4-yl)phenyl)methanamine dihydrochloride, [3-(1H-imidazol-5-yl)phenyl]methanamine;dihydrochloride.
What is the molecular weight of the compound?
The molecular weight of the compound is 246.13 g/mol.
What is the IUPAC name of the compound?
The IUPAC name of the compound is [3-(1H-imidazol-5-yl)phenyl]methanamine;dihydrochloride.
What is the InChI of the compound?
The InChI of the compound is InChI=1S/C10H11N3.2ClH/c11-5-8-2-1-3-9(4-8)10-6-12-7-13-10;;/h1-4,6-7H,5,11H2,(H,12,13);2*1H.
What is the InChIKey of the compound?
The InChIKey of the compound is IJZBZRMHZMZNQW-UHFFFAOYSA-N.
What is the canonical SMILES of the compound?
The canonical SMILES of the compound is C1=CC(=CC(=C1)C2=CN=CN2)CN.Cl.Cl.
What is the CAS number of the compound?
The CAS number of the compound is 918811-94-6.
What is the hydrogen bond donor count of the compound?
The hydrogen bond donor count of the compound is 4.
What is the hydrogen bond acceptor count of the compound?
The hydrogen bond acceptor count of the compound is 2.
Recommended Products
![Cyclohepta[b]pyrrol-8(1H)-one,7-hydroxy-3-methyl-(7ci)](https://resource.alfa-chemistry.com/structure/91880-83-0.gif)
![ACETAMIDE,N,N-[5-(AMINOMETHYL)-1,3-PHENYLENE]BIS-](https://resource.alfa-chemistry.com/structure/918810-60-3.gif)
