CAS
91828-39-6 Purity
---
91828-39-6 Purity
---
Inquiry Basket
1,4-Thiomorpholine-3,5-dicarboxylic acid
CAS
91828-95-4
Catalog Number
ACM91828954
Category
Other Products
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the molecular formula of 1,4-Thiomorpholine-3,5-dicarboxylic acid?
The molecular formula of 1,4-Thiomorpholine-3,5-dicarboxylic acid is C6H9NO4S.
What is the molecular weight of 1,4-Thiomorpholine-3,5-dicarboxylic acid?
The molecular weight of 1,4-Thiomorpholine-3,5-dicarboxylic acid is 191.21 g/mol.
What is the IUPAC name of 1,4-Thiomorpholine-3,5-dicarboxylic acid?
The IUPAC name of 1,4-Thiomorpholine-3,5-dicarboxylic acid is thiomorpholine-3,5-dicarboxylic acid.
What is the InChI of 1,4-Thiomorpholine-3,5-dicarboxylic acid?
The InChI of 1,4-Thiomorpholine-3,5-dicarboxylic acid is InChI=1S/C6H9NO4S/c8-5(9)3-1-12-2-4(7-3)6(10)11/h3-4,7H,1-2H2,(H,8,9)(H,10,11).
What is the InChIKey of 1,4-Thiomorpholine-3,5-dicarboxylic acid?
The InChIKey of 1,4-Thiomorpholine-3,5-dicarboxylic acid is MHRLWUPLSHYLOK-UHFFFAOYSA-N.
What is the canonical SMILES of 1,4-Thiomorpholine-3,5-dicarboxylic acid?
The canonical SMILES of 1,4-Thiomorpholine-3,5-dicarboxylic acid is C1C(NC(CS1)C(=O)O)C(=O)O.
What is the CAS number of 1,4-Thiomorpholine-3,5-dicarboxylic acid?
The CAS number of 1,4-Thiomorpholine-3,5-dicarboxylic acid is 91828-95-4.
What is the XLogP3-AA value of 1,4-Thiomorpholine-3,5-dicarboxylic acid?
The XLogP3-AA value of 1,4-Thiomorpholine-3,5-dicarboxylic acid is -2.8.
How many hydrogen bond donor count does 1,4-Thiomorpholine-3,5-dicarboxylic acid have?
1,4-Thiomorpholine-3,5-dicarboxylic acid has 3 hydrogen bond donor count.
How many hydrogen bond acceptor count does 1,4-Thiomorpholine-3,5-dicarboxylic acid have?
1,4-Thiomorpholine-3,5-dicarboxylic acid has 6 hydrogen bond acceptor count.
Recommended Products
CAS
91828-83-0 Purity
96%
91828-83-0 Purity
96%
![1-Propanamine,3-bromo-N-[(2,3,4-trimethoxyphenyl)methylene]-](https://resource.alfa-chemistry.com/structure/918335-87-2.gif)
CAS
918335-87-2 Purity
---
918335-87-2 Purity
---
