91807-59-9 Purity
96%
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula of the compound is C10H10N4S.
The molecular weight of the compound is 218.28 g/mol.
The IUPAC name of the compound is 4-prop-2-enyl-3-pyridin-2-yl-1H-1,2,4-triazole-5-thione.
The InChI code of the compound is InChI=1S/C10H10N4S/c1-2-7-14-9(12-13-10(14)15)8-5-3-4-6-11-8/h2-6H,1,7H2,(H,13,15).
The InChIKey of the compound is GQUMJEVEIZJHNE-UHFFFAOYSA-N.
The canonical SMILES of the compound is C=CCN1C(=NNC1=S)C2=CC=CC=N2.
The CAS number of the compound is 91813-63-7.
The compound has 1 hydrogen bond donor count.
The topological polar surface area of the compound is 72.6 Ų.
Yes, the compound is canonicalized.