917882-66-7 Purity
---
If you have any other questions or need other size, please get a quote.
The molecular formula of the compound is C16H11FN2O4.
The IUPAC name of the compound is methyl 3-(3-fluorophenyl)-2,4-dioxo-1H-quinazoline-7-carboxylate.
The molecular weight of the compound is 314.27 g/mol.
The InChI of the compound is InChI=1S/C16H11FN2O4/c1-23-15(21)9-5-6-12-13(7-9)18-16(22)19(14(12)20)11-4-2-3-10(17)8-11/h2-8H,1H3,(H,18,22).
The InChIKey of the compound is LHEMVBPUNZSUSZ-UHFFFAOYSA-N.
The canonical SMILES of the compound is COC(=O)C1=CC2=C(C=C1)C(=O)N(C(=O)N2)C3=CC(=CC=C3)F.
The XLogP3-AA value of the compound is 2.1.
The compound has 1 hydrogen bond donor count.
The compound has 5 hydrogen bond acceptor counts.
The compound has 3 rotatable bond counts.