4-Methyl-3-[[4-(3-pyridinyl)-2-pyrimidinyl]amino]benzoic acid methyl ester

Name: 4-Methyl-3-[[4-(3-pyridinyl)-2-pyrimidinyl]amino]benzoic acid methyl ester
SKU: ACM917392542
Rating: 5 (1 reviews)

CAS

917392-54-2

Catalog Number

ACM917392542

Category

Main Products

Molecular Weight

320.35

Molecular Formula

C18H16N4O2

If you have any other questions or need other size, please get a quote.

Specification

Synonyms

methyl 4-methyl-3-[[4-(3-pyridyl)pyrimidin-2-yl]amino]benzoate

Appearance

White to pale yellow to light
brown solid

What is the molecular formula of the compound?

The molecular formula of the compound is C18H16N4O2.

What are the synonyms for the compound?

The synonyms for the compound are 917392-54-2, Methyl 4-methyl-3-((4-(pyridin-3-yl)pyrimidin-2-yl)amino)benzoate, 4-METHYL-3-[[4-(3-PYRIDINYL)-2-PYRIMIDINYL]AMINO]BENZOIC ACID METHYL ESTER, HKX2YWY42Y, methyl 4-methyl-3-[(4-pyridin-3-ylpyrimidin-2-yl)amino]benzoate.

What is the molecular weight of the compound?

The molecular weight of the compound is 320.3 g/mol.

When was the compound created and last modified?

The compound was created on November 14, 2007, and last modified on October 21, 2023.

What is the IUPAC name of the compound?

The IUPAC name of the compound is methyl 4-methyl-3-[(4-pyridin-3-ylpyrimidin-2-yl)amino]benzoate.

What is the InChI of the compound?

The InChI of the compound is InChI=1S/C18H16N4O2/c1-12-5-6-13(17(23)24-2)10-16(12)22-18-20-9-7-15(21-18)14-4-3-8-19-11-14/h3-11H,1-2H3,(H,20,21,22).

What is the InChIKey of the compound?

The InChIKey of the compound is BECBKQYLJDEVDN-UHFFFAOYSA-N.

What is the Canonical SMILES of the compound?

The Canonical SMILES of the compound is CC1=C(C=C(C=C1)C(=O)OC)NC2=NC=CC(=N2)C3=CN=CC=C3.