917379-10-3 Purity
96%
If you have any other questions or need other size, please get a quote.
Specification
The IUPAC name of the compound is ethyl 5-(4-bromophenyl)-3-methyl-1,2-oxazole-4-carboxylate.
The InChI of the compound is InChI=1S/C13H12BrNO3/c1-3-17-13(16)11-8(2)15-18-12(11)9-4-6-10(14)7-5-9/h4-7H,3H2,1-2H3.
The InChIKey of the compound is NHTUYMAZAFNLIP-UHFFFAOYSA-N.
The canonical SMILES of the compound is CCOC(=O)C1=C(ON=C1C)C2=CC=C(C=C2)Br.
The molecular weight of the compound is 310.14 g/mol.
The XLogP3-AA value of the compound is 3.3.
The compound has 0 hydrogen bond donor counts.
The compound has 4 hydrogen bond acceptor counts.
The compound has 4 rotatable bond counts.
Yes, the compound is canonicalized.