91642-97-6 Purity
---
If you have any other questions or need other size, please get a quote.
Specification
The IUPAC name of the compound is 1-[4-(2-aminophenyl)piperazin-1-yl]ethanone.
The molecular formula of the compound is C12H17N3O.
The molecular weight of the compound is 219.28 g/mol.
The CAS number of the compound is 91646-45-6.
The InChI of the compound is InChI=1S/C12H17N3O/c1-10(16)14-6-8-15(9-7-14)12-5-3-2-4-11(12)13/h2-5H,6-9,13H2,1H3.
The InChIKey of the compound is PRAAXUFHOPUWRQ-UHFFFAOYSA-N.
The XLogP3-AA value of the compound is 0.6.
There is 1 hydrogen bond donor atom in the compound.
There are 3 hydrogen bond acceptor atoms in the compound.
There is 1 rotatable bond in the compound.