916420-32-1 Purity
---
If you have any other questions or need other size, please get a quote.
Specification
The IUPAC name of the compound is methyl 4-amino-1-[(4-fluorophenyl)methyl]piperidine-4-carboxylate dihydrochloride.
The InChI of the compound is InChI=1S/C14H19FN2O2.2ClH/c1-19-13(18)14(16)6-8-17(9-7-14)10-11-2-4-12(15)5-3-11;;/h2-5H,6-10,16H2,1H3;2*1H.
The InChIKey of the compound is ZIHHSILLJOGVJP-UHFFFAOYSA-N.
The molecular weight of the compound is 339.2 g/mol.
There are 3 hydrogen bond donor counts in the compound.
There are 5 hydrogen bond acceptor counts in the compound.
There are 4 rotatable bond counts in the compound.
The exact mass of the compound is 338.0964115 g/mol.
The topological polar surface area of the compound is 55.6Ų.
There are 21 heavy atom counts in the compound.
Please kindly note that our products are for research use only.
Download