916420-32-1 Purity
---
If you have any other questions or need other size, please get a quote.
Specification
The IUPAC name of the compound is methyl 4-amino-1-[(4-fluorophenyl)methyl]piperidine-4-carboxylate dihydrochloride.
The InChI of the compound is InChI=1S/C14H19FN2O2.2ClH/c1-19-13(18)14(16)6-8-17(9-7-14)10-11-2-4-12(15)5-3-11;;/h2-5H,6-10,16H2,1H3;2*1H.
The InChIKey of the compound is ZIHHSILLJOGVJP-UHFFFAOYSA-N.
The molecular weight of the compound is 339.2 g/mol.
There are 3 hydrogen bond donor counts in the compound.
There are 5 hydrogen bond acceptor counts in the compound.
There are 4 rotatable bond counts in the compound.
The exact mass of the compound is 338.0964115 g/mol.
The topological polar surface area of the compound is 55.6Ų.
There are 21 heavy atom counts in the compound.