91618-22-3 Purity
---
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula of the compound is C12H18N2O2S.
The molecular weight of the compound is 254.35 g/mol.
The IUPAC name of the compound is 3-(azepan-1-ylsulfonyl)aniline.
The InChI of the compound is InChI=1S/C12H18N2O2S/c13-11-6-5-7-12(10-11)17(15,16)14-8-3-1-2-4-9-14/h5-7,10H,1-4,8-9,13H2.
The InChIKey of the compound is OXDMSVNDLGEMFK-UHFFFAOYSA-N.
The canonical SMILES of the compound is C1CCCN(CC1)S(=O)(=O)C2=CC=CC(=C2)N.
The CAS number of the compound is 91619-39-5.
The ChEMBL ID of the compound is CHEMBL4537663.
The XLogP3-AA value of the compound is 1.6.
The hydrogen bond donor count of the compound is 1.