91599-75-6 Purity
---
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula of the compound is C7H11F3O3.
The molecular weight of the compound is 200.16 g/mol.
The IUPAC name of the compound is ethyl 4,4,4-trifluoro-3-hydroxy-2-methylbutanoate.
The InChI of the compound is InChI=1S/C7H11F3O3/c1-3-13-6(12)4(2)5(11)7(8,9)10/h4-5,11H,3H2,1-2H3.
The InChIKey of the compound is MFRIOKNLYRUYHP-UHFFFAOYSA-N.
The canonical SMILES of the compound is CCOC(=O)C(C)C(C(F)(F)F)O.
The CAS number of the compound is 649-56-9.
The EC number of the compound is 670-546-8.
The XLogP3-AA value of the compound is 1.5.
Yes, the compound is canonicalized according to PubChem.