CAS
915923-42-1 Purity
---
915923-42-1 Purity
---
Inquiry Basket
Chembrdg-bb 4017796
CAS
915923-50-1
Catalog Number
ACM915923501
Category
Other Products
Molecular Formula
C6H10N2O2
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
Specification
Synonyms
CHEMBRDG-BB 4017796;(5-PROPYL-1,2,4-OXADIAZOL-3-YL)METHANOL
What is the molecular formula of the compound with Chembrdg-bb 4017796 as a synonym?
The molecular formula is C6H10N2O2.
What is the molecular weight of the compound with Chembrdg-bb 4017796 as a synonym?
The molecular weight is 142.16 g/mol.
What is the IUPAC name of the compound with the synonym Chembrdg-bb 4017796?
The IUPAC name is (5-propyl-1,2,4-oxadiazol-3-yl)methanol.
What is the InChI of the compound with the synonym Chembrdg-bb 4017796?
The InChI is InChI=1S/C6H10N2O2/c1-2-3-6-7-5(4-9)8-10-6/h9H,2-4H2,1H3.
What is the Canonical SMILES of the compound with the synonym Chembrdg-bb 4017796?
The Canonical SMILES is CCCC1=NC(=NO1)CO.
What is the CAS number of the compound with Chembrdg-bb 4017796 as a synonym?
The CAS number is 915923-50-1.
How many hydrogen bond donor counts are there in the compound with the synonym Chembrdg-bb 4017796?
There is 1 hydrogen bond donor count.
What is the topological polar surface area of the compound with Chembrdg-bb 4017796 as a synonym?
The topological polar surface area is 59.2 Å2.
Is the compound with the synonym Chembrdg-bb 4017796 canonicalized?
Yes, the compound is canonicalized.
What is the complexity value of the compound with the synonym Chembrdg-bb 4017796?
The complexity value is 99.7.
Recommended Products
![3-[(3,3-Dimethylbutanoyl)amino]benzoic acid](https://resource.alfa-chemistry.com/structure/915923-42-1.gif)
