What is the molecular formula of 4-Methyl-3-(2-oxoimidazolidin-1-yl)benzoic acid?
The molecular formula is C11H12N2O3.
What is the molecular weight of 4-Methyl-3-(2-oxoimidazolidin-1-yl)benzoic acid?
The molecular weight is 220.22 g/mol.
What are some synonyms for 4-Methyl-3-(2-oxoimidazolidin-1-yl)benzoic acid?
Some synonyms include 915922-14-4, DTXSID70651043, and MFCD08060072.
What is the IUPAC name of 4-Methyl-3-(2-oxoimidazolidin-1-yl)benzoic acid?
The IUPAC name is 4-methyl-3-(2-oxoimidazolidin-1-yl)benzoic acid.
What is the InChI of 4-Methyl-3-(2-oxoimidazolidin-1-yl)benzoic acid?
The InChI is InChI=1S/C11H12N2O3/c1-7-2-3-8(10(14)15)6-9(7)13-5-4-12-11(13)16/h2-3,6H,4-5H2,1H3,(H,12,16)(H,14,15).
What is the InChIKey of 4-Methyl-3-(2-oxoimidazolidin-1-yl)benzoic acid?
The InChIKey is IIIUPHBWZXOBMI-UHFFFAOYSA-N.
What is the canonical SMILES of 4-Methyl-3-(2-oxoimidazolidin-1-yl)benzoic acid?
The canonical SMILES is CC1=C(C=C(C=C1)C(=O)O)N2CCNC2=O.
How many hydrogen bond donor counts does 4-Methyl-3-(2-oxoimidazolidin-1-yl)benzoic acid have?
It has 2 hydrogen bond donor counts.
What is the topological polar surface area of 4-Methyl-3-(2-oxoimidazolidin-1-yl)benzoic acid?
The topological polar surface area is 69.6 Ų.
Is 4-Methyl-3-(2-oxoimidazolidin-1-yl)benzoic acid a canonicalized compound?
Yes, it is a canonicalized compound.