What is the molecular formula of Benzenamine,3-[(6-methyl-2-pyrazinyl)oxy]?
The molecular formula is C11H11N3O.
What is the molecular weight of Benzenamine,3-[(6-methyl-2-pyrazinyl)oxy]?
The molecular weight is 201.22 g/mol.
What is the IUPAC name of Benzenamine,3-[(6-methyl-2-pyrazinyl)oxy]?
The IUPAC name is 3-(6-methylpyrazin-2-yl)oxyaniline.
What is the InChI of Benzenamine,3-[(6-methyl-2-pyrazinyl)oxy]?
The InChI is InChI=1S/C11H11N3O/c1-8-6-13-7-11(14-8)15-10-4-2-3-9(12)5-10/h2-7H,12H2,1H3.
What is the InChIKey of Benzenamine,3-[(6-methyl-2-pyrazinyl)oxy]?
The InChIKey is ZFDWDKWQAXTCSU-UHFFFAOYSA-N.
What is the canonical SMILES of Benzenamine,3-[(6-methyl-2-pyrazinyl)oxy]?
The canonical SMILES is CC1=CN=CC(=N1)OC2=CC=CC(=C2)N.
How many hydrogen bond donor counts are there in Benzenamine,3-[(6-methyl-2-pyrazinyl)oxy]?
There is 1 hydrogen bond donor count.
How many hydrogen bond acceptor counts are there in Benzenamine,3-[(6-methyl-2-pyrazinyl)oxy]?
There are 4 hydrogen bond acceptor counts.
What is the complexity value of Benzenamine,3-[(6-methyl-2-pyrazinyl)oxy]?
The complexity value is 200.
Is the compound canonicalized for Benzenamine,3-[(6-methyl-2-pyrazinyl)oxy]?
Yes, the compound is canonicalized.