91564-96-4 Purity
96%
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula of the compound is C12H14N2O3.
The molecular weight of the compound is 234.25 g/mol.
Some synonyms for the compound are 5-[2-(4-hydroxyphenyl)ethyl]-5-methylimidazolidine-2,4-dione, 91567-45-2, and 5-(4-Hydroxyphenethyl)-5-methylimidazolidine-2,4-dione.
The IUPAC name of the compound is 5-[2-(4-hydroxyphenyl)ethyl]-5-methylimidazolidine-2,4-dione.
The InChI of the compound is InChI=1S/C12H14N2O3/c1-12(10(16)13-11(17)14-12)7-6-8-2-4-9(15)5-3-8/h2-5,15H,6-7H2,1H3,(H2,13,14,16,17).
The InChIKey of the compound is XUIFFZGCVHKMNX-UHFFFAOYSA-N.
The canonical SMILES of the compound is CC1(C(=O)NC(=O)N1)CCC2=CC=C(C=C2)O.
The CAS number of the compound is 91567-45-2.
The European Community (EC) number of the compound is 822-352-1.
Yes, the compound is canonicalized.