CAS
915402-09-4 Purity
---
915402-09-4 Purity
---
Inquiry Basket
4-([1,3]Dioxolan-2-ylmethoxy)-phenylboronic acid
CAS
915402-12-9
Catalog Number
ACM915402129
Category
Other Products
Molecular Weight
224.01822
Molecular Formula
C10H13BO5
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
Specification
Synonyms
4-([1,3]Dioxolan-2-ylmethoxy)-phenylboronic acid
What is the molecular formula of the compound?
The molecular formula of the compound is C10H13BO5.
When was the compound created and last modified?
The compound was created on 2007-12-04 and last modified on 2023-12-30.
What is the IUPAC name of the compound?
The IUPAC name of the compound is [4-(1,3-dioxolan-2-ylmethoxy)phenyl]boronic acid.
What is the Canonical SMILES representation of the compound?
The Canonical SMILES representation of the compound is B(C1=CC=C(C=C1)OCC2OCCO2)(O)O.
What is the InChI of the compound?
The InChI of the compound is InChI=1S/C10H13BO5/c12-11(13)8-1-3-9(4-2-8)16-7-10-14-5-6-15-10/h1-4,10,12-13H,5-7H2.
What is the InChIKey of the compound?
The InChIKey of the compound is XOLIAYSLUMRSGB-UHFFFAOYSA-N.
What is the molecular weight of the compound?
The molecular weight of the compound is 224.02 g/mol.
How many hydrogen bond donor counts does the compound have?
The compound has 2 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does the compound have?
The compound has 5 hydrogen bond acceptor counts.
Is the compound canonicalized?
Yes, the compound is canonicalized.
Recommended Products
![5-Cyano-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-benzo[b]thiophene](https://resource.alfa-chemistry.com/structure/915402-11-8.gif)
CAS
915402-11-8 Purity
---
915402-11-8 Purity
---
![4-([1,3]Dioxolan-2-ylmethoxy)-phenylboronic acid](https://resource.alfa-chemistry.com/structure/915402-13-0.gif)
