What is the molecular formula of (R)-tert-Butyl 1-oxo-1-(2-(pyridin-2-yl)hydrazinyl)propan-2-ylcarbamate?
The molecular formula is C13H20N4O3.
When was (R)-tert-Butyl 1-oxo-1-(2-(pyridin-2-yl)hydrazinyl)propan-2-ylcarbamate created?
It was created on July 12, 2012.
What is the computed IUPAC name of the compound?
The computed IUPAC name is tert-butyl N-[(2R)-1-oxo-1-(2-pyridin-2-ylhydrazinyl)propan-2-yl]carbamate.
What is the InChI of (R)-tert-Butyl 1-oxo-1-(2-(pyridin-2-yl)hydrazinyl)propan-2-ylcarbamate?
The InChI is InChI=1S/C13H20N4O3/c1-9(15-12(19)20-13(2,3)4)11(18)17-16-10-7-5-6-8-14-10/h5-9H,1-4H3,(H,14,16)(H,15,19)(H,17,18)/t9-/m1/s1.
What is the InChIKey of the compound?
The InChIKey is JWMMKCNHXSBARG-SECBINFHSA-N.
What is the canonical SMILES of (R)-tert-Butyl 1-oxo-1-(2-(pyridin-2-yl)hydrazinyl)propan-2-ylcarbamate?
The canonical SMILES is CC(C(=O)NNC1=CC=CC=N1)NC(=O)OC(C)(C)C.
What is the molecular weight of the compound?
The molecular weight is 280.32 g/mol.
How many hydrogen bond donor counts does (R)-tert-Butyl 1-oxo-1-(2-(pyridin-2-yl)hydrazinyl)propan-2-ylcarbamate have?
It has 3 hydrogen bond donor counts.
What is the rotatable bond count of the compound?
The rotatable bond count is 6.
Is (R)-tert-Butyl 1-oxo-1-(2-(pyridin-2-yl)hydrazinyl)propan-2-ylcarbamate a canonicalized compound?
Yes, it is a canonicalized compound according to PubChem.