914224-34-3 Purity
---
If you have any other questions or need other size, please get a quote.
Specification
The IUPAC name of the compound is methyl 5-iodo-2-methoxy-4-methylbenzoate.
The molecular formula of the compound is C10H11IO3.
The molecular weight of the compound is 306.10 g/mol.
The Canonical SMILES of the compound is CC1=CC(=C(C=C1I)C(=O)OC)OC.
There are 0 hydrogen bond donor counts present in the compound.
There are 3 hydrogen bond acceptor counts present in the compound.
The topological polar surface area of the compound is 35.5 Ų.
There are 3 rotatable bond counts present in the compound.
Yes, the compound is canonicalized.
The InChIKey of the compound is NPCVNRLZZVVKNV-UHFFFAOYSA-N.