91419-49-7 Purity
97%
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula of the compound is C6H12ClN5.
The molecular weight of the compound is 189.65 g/mol.
The IUPAC name of the compound is 4-(2H-tetrazol-5-yl)piperidine;hydrochloride.
The InChI of the compound is InChI=1S/C6H11N5.ClH/c1-3-7-4-2-5(1)6-8-10-11-9-6;/h5,7H,1-4H2,(H,8,9,10,11);1H.
The InChIKey of the compound is AHNPNCMKSKGGJK-UHFFFAOYSA-N.
The canonical SMILES of the compound is C1CNCCC1C2=NNN=N2.Cl.
The CAS number of the compound is 91419-60-2.
The compound has 3 hydrogen bond donor counts.
The compound has 4 hydrogen bond acceptor counts.
The topological polar surface area of the compound is 66.5?2.