91407-48-6 Purity
---
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula of the compound is C21H19F3N2O3.
The compound was created on 2012-03-06 and modified on 2023-12-30.
The IUPAC Name of the compound is 4-[1-[(2-hydroxyphenyl)methyl]-4,4-dimethyl-2-oxopyrrolidin-3-yl]oxy-2-(trifluoromethyl)benzonitrile.
The InChI of the compound is InChI=1S/C21H19F3N2O3/c1-20(2)12-26(11-14-5-3-4-6-17(14)27)19(28)18(20)29-15-8-7-13(10-25)16(9-15)21(22,23)24/h3-9,18,27H,11-12H2,1-2H3.
The InChIKey of the compound is GASSYLHJBZBZAQ-UHFFFAOYSA-N.
The Canonical SMILES of the compound is CC1(CN(C(=O)C1OC2=CC(=C(C=C2)C#N)C(F)(F)F)CC3=CC=CC=C3O)C.
The molecular weight of the compound is 404.4 g/mol.
The compound has 1 hydrogen bond donor count.
The exact mass of the compound is 404.13477696 g/mol.
Yes, the compound is canonicalized.