CAS
913839-78-8 Purity
96%
913839-78-8 Purity
96%
Inquiry Basket
4-Pyrazol-1-yl-phenylamine hydrochloride
CAS
913848-94-9
Catalog Number
ACM913848949
Category
Other Products
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the molecular formula of the compound?
The molecular formula of the compound is C9H10ClN3.
What is the molecular weight of the compound?
The molecular weight of the compound is 195.65 g/mol.
What is the IUPAC name of the compound?
The IUPAC name of the compound is 4-pyrazol-1-ylaniline;hydrochloride.
What is the InChI of the compound?
The InChI of the compound is InChI=1S/C9H9N3.ClH/c10-8-2-4-9(5-3-8)12-7-1-6-11-12;/h1-7H,10H2;1H.
What is the InChIKey of the compound?
The InChIKey of the compound is COQNHFGHPQKJAV-UHFFFAOYSA-N.
What is the canonical SMILES of the compound?
The canonical SMILES of the compound is C1=CN(N=C1)C2=CC=C(C=C2)N.Cl.
What is the CAS number of the compound?
The CAS number of the compound is 1820647-29-7.
What is the European Community (EC) number of the compound?
The European Community (EC) number of the compound is 812-381-8.
What is the hydrogen bond donor count of the compound?
The hydrogen bond donor count of the compound is 2.
Is the compound canonicalized?
Yes, the compound is canonicalized.
Recommended Products
![Propanoicacid,2-methyl-2-[[5-(trifluoromethyl)-2-pyridinyl]oxy]-,ethyl ester](https://resource.alfa-chemistry.com/structure/913849-17-9.gif)
CAS
913849-17-9 Purity
96%
913849-17-9 Purity
96%
![Ethanone,1-[2-(1-propenyl)phenyl]-,(Z)-(9ci)](https://resource.alfa-chemistry.com/structure/91388-34-0.gif)
