913836-27-8 Purity
98%
If you have any other questions or need other size, please get a quote.
Specification
The IUPAC name of the compound is ethyl 2-cyano-2-(4,5-dimethoxy-2-nitrophenyl)acetate.
The molecular formula of the compound is C13H14N2O6.
The synonyms for the compound are SCHEMBL4082665 and FT-0714328.
The molecular weight of the compound is 294.26 g/mol.
The InChI of the compound is InChI=1S/C13H14N2O6/c1-4-21-13(16)9(7-14)8-5-11(19-2)12(20-3)6-10(8)15(17)18/h5-6,9H,4H2,1-3H3.
The InChIKey of the compound is GZTDLNRSPSELSD-UHFFFAOYSA-N.
The canonical SMILES of the compound is CCOC(=O)C(C#N)C1=CC(=C(C=C1[N+](=O)[O-])OC)OC.
The XLogP3-AA value of the compound is 1.8.
The compound has 0 hydrogen bond donor counts.
The compound has 7 hydrogen bond acceptor counts.