913835-79-7 Purity
97%
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula of boronic acid is C14H20BNO3.
The molecular weight of boronic acid is 261.13 g/mol.
The IUPAC name of boronic acid is [4-[cyclohexyl(methyl)carbamoyl]phenyl]boronic acid.
The InChI of boronic acid is InChI=1S/C14H20BNO3/c1-16(13-5-3-2-4-6-13)14(17)11-7-9-12(10-8-11)15(18)19/h7-10,13,18-19H,2-6H2,1H3.
The InChIKey of boronic acid is HJTPGROLNSBJDQ-UHFFFAOYSA-N.
Boronic acid has 2 hydrogen bond donor counts.
Boronic acid has 3 hydrogen bond acceptor counts.
The exact mass of boronic acid is 261.1536237 g/mol.
The topological polar surface area of boronic acid is 60.8 Ų.
Yes, the compound is canonicalized.