What is the molecular formula of Boronic acid, b-[1-[(1,1-dimethylethyl)dimethylsilyl]-1H-indol-6-yl]?
The molecular formula is C14H22BNO2Si.
What is the molecular weight of Boronic acid, b-[1-[(1,1-dimethylethyl)dimethylsilyl]-1H-indol-6-yl]?
The molecular weight is 275.23 g/mol.
When was Boronic acid, b-[1-[(1,1-dimethylethyl)dimethylsilyl]-1H-indol-6-yl] created?
It was created on September 14, 2005.
What is the IUPAC Name of Boronic acid, b-[1-[(1,1-dimethylethyl)dimethylsilyl]-1H-indol-6-yl]?
The IUPAC Name is [1-[tert-butyl(dimethyl)silyl]indol-6-yl]boronic acid.
What is the InChIKey of Boronic acid, b-[1-[(1,1-dimethylethyl)dimethylsilyl]-1H-indol-6-yl]?
The InChIKey is KALVCXCOXCPCOZ-UHFFFAOYSA-N.
What is the Canonical SMILES of Boronic acid, b-[1-[(1,1-dimethylethyl)dimethylsilyl]-1H-indol-6-yl]?
The Canonical SMILES is B(C1=CC2=C(C=C1)C=CN2[Si](C)(C)C(C)(C)C)(O)O.
What is the European Community (EC) Number for Boronic acid, b-[1-[(1,1-dimethylethyl)dimethylsilyl]-1H-indol-6-yl]?
The EC Number is 691-692-9.
What is the Hydrogen Bond Donor Count of Boronic acid, b-[1-[(1,1-dimethylethyl)dimethylsilyl]-1H-indol-6-yl]?
The Hydrogen Bond Donor Count is 2.
What is the Rotatable Bond Count of Boronic acid, b-[1-[(1,1-dimethylethyl)dimethylsilyl]-1H-indol-6-yl]?
The Rotatable Bond Count is 3.
Is the Compound Is Canonicalized for Boronic acid, b-[1-[(1,1-dimethylethyl)dimethylsilyl]-1H-indol-6-yl]?
Yes, the compound is canonicalized.