913819-12-2 Purity
---
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula of the compound is C15H19NSi.
The synonyms of the compound are SCHEMBL3199991, LUTFABDUDMRJDB-UHFFFAOYSA-N, 4-Methyl-2-(3-trimethylsilylphenyl)pyridine, and 4-Methyl-2-(3-trimethylsilanyl-phenyl)-pyridine.
The molecular weight of the compound is 241.40 g/mol.
The IUPAC name of the compound is trimethyl-[3-(4-methylpyridin-2-yl)phenyl]silane.
The InChI of the compound is InChI=1S/C15H19NSi/c1-12-8-9-16-15(10-12)13-6-5-7-14(11-13)17(2,3)4/h5-11H,1-4H3.
The InChIKey of the compound is LUTFABDUDMRJDB-UHFFFAOYSA-N.
The canonical SMILES of the compound is CC1=CC(=NC=C1)C2=CC(=CC=C2)[Si](C)(C)C.
The hydrogen bond donor count of the compound is 0.
The hydrogen bond acceptor count of the compound is 1.
Yes, the compound is canonicalized.