913322-70-0 Purity
96%
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula of the compound is C10H11N5.
The molecular weight of the compound is 201.23 g/mol.
The IUPAC name of the compound is 4-(3-ethylpyrazin-2-yl)pyrimidin-2-amine.
The InChI of the compound is InChI=1S/C10H11N5/c1-2-7-9(13-6-5-12-7)8-3-4-14-10(11)15-8/h3-6H,2H2,1H3,(H2,11,14,15).
The InChIKey of the compound is YDDJUWLWIRIXBK-UHFFFAOYSA-N.
The canonical SMILES of the compound is CCC1=NC=CN=C1C2=NC(=NC=C2)N.
The CAS number of the compound is 913322-74-4.
The DSSTox Substance ID of the compound is DTXSID50699145.
Yes, the compound's structure is canonicalized.