CAS
913322-66-4 Purity
---
913322-66-4 Purity
---
Inquiry Basket
4-(2-Chloro-4-bromophenyl)pyrimidin-2-amine
CAS
913322-69-7
Catalog Number
ACM913322697
Category
Other Products
Molecular Weight
284.53968
Molecular Formula
C10H7BrClN3
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
Specification
Synonyms
4-(2-CHLORO-4-BROMOPHENYL)PYRIMIDIN-2-AMINE
What is the molecular formula of the compound?
The molecular formula of the compound is C10H7BrClN3.
When was the compound created and modified?
The compound was created on October 30, 2011, and modified on December 30, 2023.
What is the IUPAC name of the compound?
The IUPAC name of the compound is 4-(4-bromo-2-chlorophenyl)pyrimidin-2-amine.
What is the InChI of the compound?
The InChI of the compound is InChI=1S/C10H7BrClN3/c11-6-1-2-7(8(12)5-6)9-3-4-14-10(13)15-9/h1-5H,(H2,13,14,15).
What is the InChIKey of the compound?
The InChIKey of the compound is AAWAPANBKDJXNO-UHFFFAOYSA-N.
What is the canonical SMILES of the compound?
The canonical SMILES of the compound is C1=CC(=C(C=C1Br)Cl)C2=NC(=NC=C2)N.
What is the molecular weight of the compound?
The molecular weight of the compound is 284.54 g/mol.
How many hydrogen bond donor counts does the compound have?
The compound has 1 hydrogen bond donor count.
How many hydrogen bond acceptor counts does the compound have?
The compound has 3 hydrogen bond acceptor counts.
What is the topological polar surface area of the compound?
The topological polar surface area of the compound is 51.8 ㎡.
Recommended Products
