912770-11-7 Purity
---
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula of the compound is C12H7BrN2O2S.
The molecular weight of the compound is 323.17 g/mol.
The IUPAC name of the compound is 6-(3-bromophenyl)imidazo[2,1-b][1,3]thiazole-3-carboxylic acid.
The InChI of the compound is InChI=1S/C12H7BrN2O2S/c13-8-3-1-2-7(4-8)9-5-15-10(11(16)17)6-18-12(15)14-9/h1-6H,(H,16,17).
The InChIKey of the compound is VALRASYDSTUACR-UHFFFAOYSA-N.
The canonical SMILES of the compound is C1=CC(=CC(=C1)Br)C2=CN3C(=CSC3=N2)C(=O)O.
The XLogP3-AA value of the compound is 4.1.
The hydrogen bond donor count of the compound is 1.
The hydrogen bond acceptor count of the compound is 4.
The compound has 2 rotatable bonds.