912770-05-9 Purity
---
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula of the compound is C13H10N2O2S.
The molecular weight of the compound is 258.30 g/mol.
The CAS number of the compound is 912770-19-5.
The IUPAC name of the compound is 6-(3-methylphenyl)imidazo[2,1-b][1,3]thiazole-3-carboxylic acid.
The Canonical SMILES representation of the compound is CC1=CC(=CC=C1)C2=CN3C(=CSC3=N2)C(=O)O.
The InChI of the compound is InChI=1S/C13H10N2O2S/c1-8-3-2-4-9(5-8)10-6-15-11(12(16)17)7-18-13(15)14-10/h2-7H,1H3,(H,16,17).
The InChIKey of the compound is DUMIMFQWJWGVCA-UHFFFAOYSA-N.
The XLogP3-AA value of the compound is 3.7.
The compound has 1 hydrogen bond donor count.
The topological polar surface area of the compound is 82.8 ?2.