CAS
91245-59-9 Purity
---
91245-59-9 Purity
---
Shopping basket
Cyclobutanamine,1-(phenylmethyl)-
CAS
91245-60-2
Catalog Number
ACM91245602
Category
Other Products
- CAS
- Size
- Purity
- Price
- Quantity
- Order
- 91245-60-2
- -
- -
- -
-
- +
- Add To Cart Inquiry
If you have any other questions or need other size, please get a quote.
- Custom Q&A
What is the molecular formula of Cyclobutanamine, 1-(phenylmethyl)?
The molecular formula of Cyclobutanamine, 1-(phenylmethyl) is C11H15N.
What is the molecular weight of Cyclobutanamine, 1-(phenylmethyl)?
The molecular weight of Cyclobutanamine, 1-(phenylmethyl) is 161.24 g/mol.
What is the IUPAC name of Cyclobutanamine, 1-(phenylmethyl)?
The IUPAC name of Cyclobutanamine, 1-(phenylmethyl) is 1-benzylcyclobutan-1-amine.
What is the InChI of Cyclobutanamine, 1-(phenylmethyl)?
The InChI of Cyclobutanamine, 1-(phenylmethyl) is InChI=1S/C11H15N/c12-11(7-4-8-11)9-10-5-2-1-3-6-10/h1-3,5-6H,4,7-9,12H2.
What is the InChIKey of Cyclobutanamine, 1-(phenylmethyl)?
The InChIKey of Cyclobutanamine, 1-(phenylmethyl) is VDTOJIIWQIMYNV-UHFFFAOYSA-N.
What is the canonical SMILES of Cyclobutanamine, 1-(phenylmethyl)?
The canonical SMILES of Cyclobutanamine, 1-(phenylmethyl) is C1CC(C1)(CC2=CC=CC=C2)N.
How many hydrogen bond donor counts does Cyclobutanamine, 1-(phenylmethyl) have?
Cyclobutanamine, 1-(phenylmethyl) has 1 hydrogen bond donor count.
What is the exact mass of Cyclobutanamine, 1-(phenylmethyl)?
The exact mass of Cyclobutanamine, 1-(phenylmethyl) is 161.120449483 g/mol.
Does Cyclobutanamine, 1-(phenylmethyl) have any defined atom stereocenter count?
No, Cyclobutanamine, 1-(phenylmethyl) does not have any defined atom stereocenter count.
Is Cyclobutanamine, 1-(phenylmethyl) a canonicalized compound?
Yes, Cyclobutanamine, 1-(phenylmethyl) is a canonicalized compound.
Recommended Products
