CAS
91229-91-3 Purity
---
91229-91-3 Purity
---
Inquiry Basket
3-Pyridazinamine,6-methyl-4-(1-methylethyl)-
CAS
912331-53-4
Catalog Number
ACM912331534
Category
Other Products
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the PubChem CID of 3-Pyridazinamine, 6-methyl-4-(1-methylethyl)?
The PubChem CID of 3-Pyridazinamine, 6-methyl-4-(1-methylethyl) is 45116643.
What is the molecular formula of 3-Pyridazinamine, 6-methyl-4-(1-methylethyl)?
The molecular formula of 3-Pyridazinamine, 6-methyl-4-(1-methylethyl) is C8H13N3.
What is the IUPAC Name of 3-Pyridazinamine, 6-methyl-4-(1-methylethyl)?
The IUPAC Name of 3-Pyridazinamine, 6-methyl-4-(1-methylethyl) is 6-methyl-4-propan-2-ylpyridazin-3-amine.
What is the InChI of 3-Pyridazinamine, 6-methyl-4-(1-methylethyl)?
The InChI of 3-Pyridazinamine, 6-methyl-4-(1-methylethyl) is InChI=1S/C8H13N3/c1-5(2)7-4-6(3)10-11-8(7)9/h4-5H,1-3H3,(H2,9,11).
What is the InChIKey of 3-Pyridazinamine, 6-methyl-4-(1-methylethyl)?
The InChIKey of 3-Pyridazinamine, 6-methyl-4-(1-methylethyl) is WOYZKVZZODHILN-UHFFFAOYSA-N.
What is the Canonical SMILES of 3-Pyridazinamine, 6-methyl-4-(1-methylethyl)?
The Canonical SMILES of 3-Pyridazinamine, 6-methyl-4-(1-methylethyl) is CC1=CC(=C(N=N1)N)C(C)C.
What is the CAS number of 3-Pyridazinamine, 6-methyl-4-(1-methylethyl)?
The CAS number of 3-Pyridazinamine, 6-methyl-4-(1-methylethyl) is 912331-53-4.
What is the molecular weight of 3-Pyridazinamine, 6-methyl-4-(1-methylethyl)?
The molecular weight of 3-Pyridazinamine, 6-methyl-4-(1-methylethyl) is 151.21 g/mol.
What is the XLogP3-AA value of 3-Pyridazinamine, 6-methyl-4-(1-methylethyl)?
The XLogP3-AA value of 3-Pyridazinamine, 6-methyl-4-(1-methylethyl) is 1.
What is the hydrogen bond donor count of 3-Pyridazinamine, 6-methyl-4-(1-methylethyl)?
The hydrogen bond donor count of 3-Pyridazinamine, 6-methyl-4-(1-methylethyl) is 1.
Recommended Products
![3-Methyl-benzo[b]thiophene-2-boronic acid](https://resource.alfa-chemistry.com/structure/912331-27-2.gif)
