91178-24-4 Purity
---
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula of the compound is C7H13N3.
The molecular weight of the compound is 139.20 g/mol.
The IUPAC name of the compound is 1-(1,3-dimethylpyrazol-4-yl)ethanamine.
The InChI of the compound is InChI=1S/C7H13N3/c1-5(8)7-4-10(3)9-6(7)2/h4-5H,8H2,1-3H3.
The InChIKey of the compound is ZHCIXQMRFVTGGF-UHFFFAOYSA-N.
The canonical SMILES of the compound is CC1=NN(C=C1C(C)N)C.
The CAS number of the compound is 911788-36-8.
The XLogP3-AA value of the compound is -0.1.
The compound has 1 hydrogen bond donor count.
The compound has 2 hydrogen bond acceptor counts.