What is the molecular formula of 4-Morpholinecarboxylic acid, 3-methoxy-5-methyl-, methyl ester?
The molecular formula is C8H15NO4.
What are the synonyms for 4-Morpholinecarboxylic acid, 3-methoxy-5-methyl-, methyl ester?
The synonyms are 911222-23-6 and 4-morpholinecarboxylic acid, 3-methoxy-5-methyl-, methyl ester.
What is the molecular weight of 4-Morpholinecarboxylic acid, 3-methoxy-5-methyl-, methyl ester?
The molecular weight is 189.21 g/mol.
When was 4-Morpholinecarboxylic acid, 3-methoxy-5-methyl-, methyl ester created in PubChem?
It was created on April 23, 2010.
When was 4-Morpholinecarboxylic acid, 3-methoxy-5-methyl-, methyl ester last modified in PubChem?
It was last modified on December 30, 2023.
What is the IUPAC name of 4-Morpholinecarboxylic acid, 3-methoxy-5-methyl-, methyl ester?
The IUPAC name is methyl 3-methoxy-5-methylmorpholine-4-carboxylate.
What is the InChI of 4-Morpholinecarboxylic acid, 3-methoxy-5-methyl-, methyl ester?
The InChI is InChI=1S/C8H15NO4/c1-6-4-13-5-7(11-2)9(6)8(10)12-3/h6-7H,4-5H2,1-3H3.
What is the InChIKey of 4-Morpholinecarboxylic acid, 3-methoxy-5-methyl-, methyl ester?
The InChIKey is INUWGLLJEPUHBA-UHFFFAOYSA-N.
What is the canonical SMILES of 4-Morpholinecarboxylic acid, 3-methoxy-5-methyl-, methyl ester?
The canonical SMILES is CC1COCC(N1C(=O)OC)OC.
What is the XLogP3-AA value of 4-Morpholinecarboxylic acid, 3-methoxy-5-methyl-, methyl ester?
The XLogP3-AA value is 0.2.