CAS
91099-24-0 Purity
---
91099-24-0 Purity
---
Inquiry Basket
2,5-Dichloro-4-[4,5-dihydro-3-methyl-5-oxo-4-[[3-[(phenylamino)sulphonyl]phenyl]azo]-1H-pyrazol-1-yl]benzenesulphonic acid
CAS
91101-21-2
Catalog Number
ACM91101212
Category
Other Products
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the molecular formula of the compound?
The molecular formula of the compound is C22H17Cl2N5O6S2.
What are the synonyms for the compound?
The synonyms for the compound include 91101-21-2, 2,5-Dichloro-4-(4,5-dihydro-3-methyl-5-oxo-4-((3-((phenylamino)sulphonyl)phenyl)azo)-1H-pyrazol-1-yl)benzenesulphonic acid, and EINECS 293-813-7.
When was the compound first created?
The compound was first created in 2005.
What is the molecular weight of the compound?
The molecular weight of the compound is 582.4 g/mol.
What is the IUPAC name of the compound?
The IUPAC name of the compound is 2,5-dichloro-4-[3-methyl-5-oxo-4-[[3-(phenylsulfamoyl)phenyl]diazenyl]-4H-pyrazol-1-yl]benzenesulfonic acid.
What is the Canonical SMILES representation of the compound?
The Canonical SMILES representation of the compound is CC1=NN(C(=O)C1N=NC2=CC(=CC=C2)S(=O)(=O)NC3=CC=CC=C3)C4=CC(=C(C=C4Cl)S(=O)(=O)O)Cl.
What is the InChIKey for the compound?
The InChIKey for the compound is NJOYTYKWRUYHOV-UHFFFAOYSA-N.
How many hydrogen bond donor counts does the compound have?
The compound has 2 hydrogen bond donor counts.
What is the XLogP3-AA value of the compound?
The XLogP3-AA value of the compound is 3.8.
How many rotatable bond counts does the compound have?
The compound has 7 rotatable bond counts.
Recommended Products
CAS
910-99-6 Purity
96%
910-99-6 Purity
96%
CAS
91099-82-0 Purity
96%
91099-82-0 Purity
96%
