910908-09-7 Purity
96%
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula of the compound is C11H10N4.
The molecular weight of the compound is 198.22 g/mol.
The IUPAC name of the compound is 5-amino-1-benzylpyrazole-4-carbonitrile.
The InChI of the compound is InChI=1S/C11H10N4/c12-6-10-7-14-15(11(10)13)8-9-4-2-1-3-5-9/h1-5,7H,8,13H2.
The InChIKey of the compound is GAVXFBPVQOBHDS-UHFFFAOYSA-N.
The canonical SMILES of the compound is C1=CC=C(C=C1)CN2C(=C(C=N2)C#N)N.
The CAS number of the compound is 91091-13-3.
The EC number of the compound is 849-797-4.
The ChEMBL ID of the compound is CHEMBL1406925.
Yes, the compound is canonicalized according to PubChem.