910654-43-2 Purity
96%
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula of the compound is C11H11ClN2O.
The IUPAC name of the compound is 5-(3-chloropropyl)-3-phenyl-1,2,4-oxadiazole.
The molecular weight of the compound is 222.67 g/mol.
The InChI key of the compound is KGPLNKMMWKJLJA-UHFFFAOYSA-N.
The canonical SMILES of the compound is C1=CC=C(C=C1)C2=NOC(=N2)CCCCl.
The CAS number of the compound is 91066-23-8.
The compound has 0 hydrogen bond donor counts.
The compound has 3 hydrogen bond acceptor counts.
The compound has 4 rotatable bond counts.
Yes, the compound is canonicalized.