91059-97-1 Purity
96%
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula of the compound is C11H9ClN2O.
The molecular weight of the compound is 220.65 g/mol.
The IUPAC name of the compound is 3-chloro-6-phenylmethoxypyridazine.
The InChI of the compound is InChI=1S/C11H9ClN2O/c12-10-6-7-11(14-13-10)15-8-9-4-2-1-3-5-9/h1-7H,8H2.
The InChIKey of the compound is YRAUAJNDSLLHKM-UHFFFAOYSA-N.
The Canonical SMILES of the compound is C1=CC=C(C=C1)COC2=NN=C(C=C2)Cl.
The CAS number of the compound is 91063-19-3.
The XLogP3-AA value of the compound is 2.6.
There are 0 hydrogen bond donor counts in the compound.
Yes, the compound is canonicalized according to PubChem.