CAS
91059-42-6 Purity
96%
91059-42-6 Purity
96%
Inquiry Basket
Benzaldehyde,3-hydroxy-4-(1-methylethyl)-(9ci)
CAS
91060-93-4
Catalog Number
ACM91060934
Category
Other Products
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the molecular formula of benzaldehyde, 3-hydroxy-4-(1-methylethyl)-(9ci)?
The molecular formula of benzaldehyde, 3-hydroxy-4-(1-methylethyl)-(9ci) is C10H12O2.
What is the molecular weight of benzaldehyde, 3-hydroxy-4-(1-methylethyl)-(9ci)?
The molecular weight of benzaldehyde, 3-hydroxy-4-(1-methylethyl)-(9ci) is 164.20 g/mol.
What is the IUPAC name of benzaldehyde, 3-hydroxy-4-(1-methylethyl)-(9ci)?
The IUPAC name of benzaldehyde, 3-hydroxy-4-(1-methylethyl)-(9ci) is 3-hydroxy-4-propan-2-ylbenzaldehyde.
What is the InChI of benzaldehyde, 3-hydroxy-4-(1-methylethyl)-(9ci)?
The InChI of benzaldehyde, 3-hydroxy-4-(1-methylethyl)-(9ci) is InChI=1S/C10H12O2/c1-7(2)9-4-3-8(6-11)5-10(9)12/h3-7,12H,1-2H3.
What is the InChIKey of benzaldehyde, 3-hydroxy-4-(1-methylethyl)-(9ci)?
The InChIKey of benzaldehyde, 3-hydroxy-4-(1-methylethyl)-(9ci) is AAHPQRUIQYEFLD-UHFFFAOYSA-N.
What is the canonical SMILES of benzaldehyde, 3-hydroxy-4-(1-methylethyl)-(9ci)?
The canonical SMILES of benzaldehyde, 3-hydroxy-4-(1-methylethyl)-(9ci) is CC(C)C1=C(C=C(C=C1)C=O)O.
What is the CAS number of benzaldehyde, 3-hydroxy-4-(1-methylethyl)-(9ci)?
The CAS number of benzaldehyde, 3-hydroxy-4-(1-methylethyl)-(9ci) is 91060-93-4.
How many hydrogen bond donor counts does benzaldehyde, 3-hydroxy-4-(1-methylethyl)-(9ci) have?
Benzaldehyde, 3-hydroxy-4-(1-methylethyl)-(9ci) has 1 hydrogen bond donor count.
How many hydrogen bond acceptor counts does benzaldehyde, 3-hydroxy-4-(1-methylethyl)-(9ci) have?
Benzaldehyde, 3-hydroxy-4-(1-methylethyl)-(9ci) has 2 hydrogen bond acceptor counts.
Recommended Products
