3,4-Furandicarboxylic acid,2-[(1,1-dimethylethyl)amino]-5-[(1,1-dimethylethyl)(phenylacetyl)amino]-,diethyl ester(9ci)

CAS

910578-24-4

Catalog Number

ACM910578244

Category

Other Products

MSDS COA Spec Sheet

If you have any other questions or need other size, please get a quote.

What is the PubChem CID of the compound?

The PubChem CID of the compound is 45119663.

What is the molecular formula of the compound?

The molecular formula of the compound is C26H36N2O6.

What are the synonyms of the compound?

The synonyms of the compound are 910578-24-4 and 3,4-Furandicarboxylic acid, 2-[(1,1-dimethylethyl)amino]-5-[(1,1-dimethylethyl)(phenylacetyl)amino]-, diethyl ester(9ci).

What is the molecular weight of the compound?

The molecular weight of the compound is 472.6 g/mol.

What is the IUPAC name of the compound?

The IUPAC name of the compound is diethyl 2-(tert-butylamino)-5-[tert-butyl-(2-phenylacetyl)amino]furan-3,4-dicarboxylate.

What is the InChI of the compound?

The InChI of the compound is InChI=1S/C26H36N2O6/c1-9-32-23(30)19-20(24(31)33-10-2)22(34-21(19)27-25(3,4)5)28(26(6,7)8)18(29)16-17-14-12-11-13-15-17/h11-15,27H,9-10,16H2,1-8H3.

What is the InChIKey of the compound?

The InChIKey of the compound is XIXNRGGTEQONGK-UHFFFAOYSA-N.

What is the Canonical SMILES of the compound?

The Canonical SMILES of the compound is CCOC(=O)C1=C(OC(=C1C(=O)OCC)N(C(=O)CC2=CC=CC=C2)C(C)(C)C)NC(C)(C)C.

What is the XLogP3-AA value of the compound?

The XLogP3-AA value of the compound is 5.6.

How many hydrogen bond donor counts does the compound have?

The compound has 1 hydrogen bond donor count.

Recommended Products