CAS
91053-51-9 Purity
---
91053-51-9 Purity
---
Inquiry Basket
3-Amino-5-bromo-1-methylpyridin-2(1H)-one
CAS
910543-72-5
Catalog Number
ACM910543725
Category
Other Products
Molecular Weight
203
Molecular Formula
C6H7BrN2O
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the molecular formula of the compound?
The molecular formula of the compound is C6H7BrN2O.
What is the molecular weight of the compound?
The molecular weight of the compound is 203.04 g/mol.
What is the IUPAC name of the compound?
The IUPAC name of the compound is 3-amino-5-bromo-1-methylpyridin-2-one.
What is the InChI of the compound?
The InChI of the compound is InChI=1S/C6H7BrN2O/c1-9-3-4(7)2-5(8)6(9)10/h2-3H,8H2,1H3.
What is the InChIKey of the compound?
The InChIKey of the compound is KRUDZWOELKQDJW-UHFFFAOYSA-N.
What is the CAS number of the compound?
The CAS number of the compound is 910543-72-5.
What is the EC number of the compound?
The EC number of the compound is 838-612-2.
What is the XLogP3-AA value of the compound?
The XLogP3-AA value of the compound is 0.3.
How many hydrogen bond donors are present in the compound?
There is 1 hydrogen bond donor in the compound.
How many hydrogen bond acceptors are present in the compound?
There are 2 hydrogen bond acceptors in the compound.
Recommended Products
![3,3'-[(2-Hydroxypropane-1,3-diyl)bis(oxy)]bispropiononitrile](https://resource.alfa-chemistry.com/structure/91054-94-3.gif)
CAS
91054-94-3 Purity
96%
91054-94-3 Purity
96%
