N-Deshydroxyethyl dasatinib

CAS

910297-51-7

Catalog Number

ACM910297517

Category

Other Products

Molecular Formula

C₂₀H₂₂ClN₇OS

MSDS COA Spec Sheet

If you have any other questions or need other size, please get a quote.

Specification

Synonyms

N-(2-Chloro-6-methylphenyl)-2-[[2-methyl-6-(1-piperazinyl)-4-pyrimidinyl]amino]-5-thiazolecarboxamide;N-Deshydroxyethyl Dasatinib;Dasatinib metabolite M4

Appearance

White to Off-White Solid

What is the molecular formula of N-Deshydroxyethyl dasatinib?

The molecular formula of N-Deshydroxyethyl dasatinib is C20H22ClN7OS.

When was N-Deshydroxyethyl dasatinib created?

N-Deshydroxyethyl dasatinib was created on October 26, 2006.

What is the IUPAC Name of N-Deshydroxyethyl dasatinib?

The IUPAC Name of N-Deshydroxyethyl dasatinib is N-(2-chloro-6-methylphenyl)-2-[(2-methyl-6-piperazin-1-ylpyrimidin-4-yl)amino]-1,3-thiazole-5-carboxamide.

What is the InChIKey of N-Deshydroxyethyl dasatinib?

The InChIKey of N-Deshydroxyethyl dasatinib is DOBZFFWLHXORTB-UHFFFAOYSA-N.

What is the Canonical SMILES of N-Deshydroxyethyl dasatinib?

The Canonical SMILES of N-Deshydroxyethyl dasatinib is CC1=C(C(=CC=C1)Cl)NC(=O)C2=CN=C(S2)NC3=CC(=NC(=N3)C)N4CCNCC4.

What is the molecular weight of N-Deshydroxyethyl dasatinib?

The molecular weight of N-Deshydroxyethyl dasatinib is 444.0 g/mol.

How many hydrogen bond donor count does N-Deshydroxyethyl dasatinib have?

N-Deshydroxyethyl dasatinib has 3 hydrogen bond donor counts.

How many rotatable bond count does N-Deshydroxyethyl dasatinib have?

N-Deshydroxyethyl dasatinib has 5 rotatable bond counts.

What is the topological polar surface area of N-Deshydroxyethyl dasatinib?

The topological polar surface area of N-Deshydroxyethyl dasatinib is 123?2.