910037-04-6 Purity
96%
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula of the compound is C14H23N3.
The molecular weight of the compound is 233.35 g/mol.
The IUPAC name of the compound is N-methyl-1-[4-(4-methyl-1,4-diazepan-1-yl)phenyl]methanamine.
The Canonical SMILES notation of the compound is CNCC1=CC=C(C=C1)N2CCCN(CC2)C.
The compound has 1 hydrogen bond donor count.
The compound has 3 hydrogen bond acceptor counts.
The exact mass of the compound is 233.189197746 g/mol.
The topological polar surface area of the compound is 18.5 Ų.
The compound has 3 rotatable bond counts.
Yes, the compound is canonicalized.