CAS
908333-99-3 Purity
---
908333-99-3 Purity
---
Inquiry Basket
4-Bromo-7-methyl-1,1-(ethylenedioxo)-indane
CAS
908334-02-1
Catalog Number
ACM908334021
Category
Other Products
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the molecular formula of the compound?
The molecular formula of the compound is C12H13BrO2.
What are the synonyms for the compound?
The synonyms for the compound are 908334-02-1, 4-Bromo-7-methyl-1,1-(ethylenedioxo)-indane, DTXSID40669791, and 4'-Bromo-7'-methyl-2',3'-dihydrospiro[1,3-dioxolane-2,1'-indene].
What is the molecular weight of the compound?
The molecular weight of the compound is 269.13 g/mol.
What is the IUPAC name of the compound?
The IUPAC name of the compound is 7-bromo-4-methylspiro[1,2-dihydroindene-3,2'-1,3-dioxolane].
What is the InChI of the compound?
The InChI of the compound is InChI=1S/C12H13BrO2/c1-8-2-3-10(13)9-4-5-12(11(8)9)14-6-7-15-12/h2-3H,4-7H2,1H3.
What is the InChIKey of the compound?
The InChIKey of the compound is ZMSHXGCHJNAZTJ-UHFFFAOYSA-N.
What is the canonical SMILES of the compound?
The canonical SMILES of the compound is CC1=C2C(=C(C=C1)Br)CCC23OCCO3.
What is the XLogP3-AA value of the compound?
The XLogP3-AA value of the compound is 2.6.
How many hydrogen bond donor counts does the compound have?
The compound has 0 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does the compound have?
The compound has 2 hydrogen bond acceptor counts.
Recommended Products
