CAS
90829-95-1 Purity
---
90829-95-1 Purity
---
Inquiry Basket
2-(3-Bromo-phenyl)-4-methyl-2,5-dihydro-[1,2,3]thiadiazole 1,1-dioxide
CAS
908333-93-7
Catalog Number
ACM908333937
Category
Other Products
Molecular Weight
289.14896
Molecular Formula
C9H9BrN2O2S
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
Specification
Synonyms
2-(3-Bromo-phenyl)-4-methyl-2,5-dihydro-[1,2,3]thiadiazole 1,1-dioxide
What is the molecular formula of the compound?
The molecular formula of the compound is C9H9BrN2O2S.
What is the molecular weight of the compound?
The molecular weight of the compound is 289.15 g/mol.
What is the IUPAC name of the compound?
The IUPAC name of the compound is 2-(3-bromophenyl)-4-methyl-5H-thiadiazole 1,1-dioxide.
What is the InChI of the compound?
The InChI of the compound is InChI=1S/C9H9BrN2O2S/c1-7-6-15(13,14)12(11-7)9-4-2-3-8(10)5-9/h2-5H,6H2,1H3.
What is the InChIKey of the compound?
The InChIKey of the compound is RINCAIVZAWAFTF-UHFFFAOYSA-N.
What is the canonical SMILES of the compound?
The canonical SMILES of the compound is CC1=NN(S(=O)(=O)C1)C2=CC(=CC=C2)Br.
What is the CAS number of the compound?
The CAS number of the compound is 908333-93-7.
What is the XLogP3-AA value of the compound?
The XLogP3-AA value of the compound is 1.6.
How many hydrogen bond donor count does the compound have?
The compound has 0 hydrogen bond donor count.
How many rotatable bond count does the compound have?
The compound has 1 rotatable bond count.
Recommended Products
CAS
908333-94-8 Purity
---
908333-94-8 Purity
---
