90817-19-9 Purity
---
If you have any other questions or need other size, please get a quote.
The molecular formula of the compound is C6H12O3.
The molecular weight of the compound is 132.16 g/mol.
The IUPAC name of the compound is 1-(1-hydroxypropan-2-yloxy)propan-2-one.
The InChI of the compound is InChI=1S/C6H12O3/c1-5(8)4-9-6(2)3-7/h6-7H,3-4H2,1-2H3.
The InChIKey of the compound is UKMDZQOVHHHBMS-UHFFFAOYSA-N.
The compound has 1 hydrogen bond donor count.
The topological polar surface area of the compound is 46.5 Ų.
The compound has 4 rotatable bond counts.
Yes, the compound is canonicalized.
The XLogP3-AA value of the compound is -0.4.