90817-13-3 Purity
96%
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula of the compound is C7H11N3O.
The molecular weight of the compound is 153.18 g/mol.
The IUPAC name of the compound is 6-methoxy-2-N-methylpyridine-2,3-diamine.
The InChI of the compound is InChI=1S/C7H11N3O/c1-9-7-5(8)3-4-6(10-7)11-2/h3-4H,8H2,1-2H3,(H,9,10).
The InChIKey of the compound is ATCBPVDYYNJHSG-UHFFFAOYSA-N.
The canonical SMILES of the compound is CNC1=C(C=CC(=N1)OC)N.
The CAS number of the compound is 90817-34-8.
The EC number of the compound is 620-557-9.
The monoisotopic mass of the compound is 153.090211983 g/mol.
Yes, the compound is canonicalized.