90761-62-9 Purity
96%
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula of 2-Methoxy-5-nitrobenzoyl chloride is C8H6ClNO4.
2-Methoxy-5-nitrobenzoyl chloride was created on 2007-02-08 and modified on 2023-12-30.
The IUPAC name of 2-Methoxy-5-nitrobenzoyl chloride is 2-methoxy-5-nitrobenzoyl chloride.
The InChI code for 2-Methoxy-5-nitrobenzoyl chloride is InChI=1S/C8H6ClNO4/c1-14-7-3-2-5(10(12)13)4-6(7)8(9)11/h2-4H,1H3.
The molecular weight of 2-Methoxy-5-nitrobenzoyl chloride is 215.59 g/mol.
2-Methoxy-5-nitrobenzoyl chloride has 4 hydrogen bond acceptors.
The topological polar surface area of 2-Methoxy-5-nitrobenzoyl chloride is 72.1 Ų.
2-Methoxy-5-nitrobenzoyl chloride has 2 rotatable bonds.
Yes, 2-Methoxy-5-nitrobenzoyl chloride is a canonicalized compound.
The XLogP3 value of 2-Methoxy-5-nitrobenzoyl chloride is 2.7.